EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:230523 - L-allylglycine
| Formula | C5H9NO2 |
| Net Charge | 0 |
| Average Mass | 115.132 |
| Monoisotopic Mass | 115.06333 |
| SMILES | C=CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | WNNNWFKQCKFSDK-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 4.1.1.15 (glutamate decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of glutamate decarboxylase (EC 4.1.1.15). EC 4.1.1.15 (glutamate decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of glutamate decarboxylase (EC 4.1.1.15). |
| Application: | convulsant A drug that induces seizures or increases their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-allylglycine (CHEBI:230523) has role convulsant (CHEBI:231761) |
| L-allylglycine (CHEBI:230523) has role EC 4.1.1.15 (glutamate decarboxylase) inhibitor (CHEBI:142581) |
| L-allylglycine (CHEBI:230523) is a allylglycine (CHEBI:231976) |
| L-allylglycine (CHEBI:230523) is enantiomer of D-allylglycine (CHEBI:231977) |
| Incoming Relation(s) |
| DL-allylglycine (CHEBI:231241) has part L-allylglycine (CHEBI:230523) |
| D-allylglycine (CHEBI:231977) is enantiomer of L-allylglycine (CHEBI:230523) |
| IUPAC Name |
|---|
| (2S)-2-aminopent-4-enoic acid |
| Synonyms | Source |
|---|---|
| 2-allyl-L-glycine | ChEBI |
| (2S)-2-amino-4-pentenoic acid | ChEBI |
| H-L-allylgly-OH | ChEBI |
| (S)-2-allylglycine | ChEBI |
| (S)-2-amino-4-pentenoic acid | ChEBI |
| S-(−)-2-amino-4-pentenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2AG | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:16338-48-0 | ChEBI |
| Citations |
|---|