EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N6O2 |
| Net Charge | 0 |
| Average Mass | 418.501 |
| Monoisotopic Mass | 418.21172 |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)nc(OCCc3ccccn3)n2)c1 |
| InChI | InChI=1S/C23H26N6O2/c1-18-5-4-6-19(15-18)17-25-28-21-16-22(29-10-13-30-14-11-29)27-23(26-21)31-12-8-20-7-2-3-9-24-20/h2-7,9,15-17H,8,10-14H2,1H3,(H,26,27,28)/b25-17+ |
| InChIKey | HSKAZIJJKRAJAV-KOEQRZSOSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apilimod (CHEBI:230506) has role antiviral agent (CHEBI:22587) |
| apilimod (CHEBI:230506) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| apilimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| AIT-101 | SUBMITTER |
| LAM-002A free base | SUBMITTER |
| STA 5326 | SUBMITTER |
| STA-5326 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:541550-19-0 | SUBMITTER |
| Citations |
|---|