EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H28ClN7O2 |
| Net Charge | 0 |
| Average Mass | 566.065 |
| Monoisotopic Mass | 565.19930 |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc(C(=O)Nc2cccc(Nc3ncc(Cl)c(-c4cnc5ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C31H28ClN7O2/c1-39(2)16-6-11-28(40)35-21-14-12-20(13-15-21)30(41)36-22-7-5-8-23(17-22)37-31-34-19-26(32)29(38-31)25-18-33-27-10-4-3-9-24(25)27/h3-15,17-19,33H,16H2,1-2H3,(H,35,40)(H,36,41)(H,34,37,38)/b11-6+ |
| InChIKey | OBJNFLYHUXWUPF-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| THZ1 (CHEBI:230500) has role antineoplastic agent (CHEBI:35610) |
| THZ1 (CHEBI:230500) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| THZ1 (CHEBI:230500) is a aminopyrimidine (CHEBI:38338) |
| THZ1 (CHEBI:230500) is a benzamides (CHEBI:22702) |
| THZ1 (CHEBI:230500) is a enamide (CHEBI:51751) |
| THZ1 (CHEBI:230500) is a indoles (CHEBI:24828) |
| THZ1 (CHEBI:230500) is a organochlorine compound (CHEBI:36683) |
| THZ1 (CHEBI:230500) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(3-{[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino}phenyl)-4-{[(2E)-4-(dimethylamino)but-2-enoyl]amino}benzamide |
| Synonyms | Source |
|---|---|
| THZ-1 | ChEBI |
| THZ 1 | ChEBI |
| (E)-N-(3-(5-chloro-4-(1H-indol-3-yl)pyrimidin-2-ylamino)phenyl)-4-(4-(dimethylamino)but-2-enamido)benzamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1604810-83-4 | SUBMITTER |
| Citations |
|---|