EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N8O3 |
| Net Charge | 0 |
| Average Mass | 562.719 |
| Monoisotopic Mass | 562.33799 |
| SMILES | CC(C)N(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)[C@H]1C[C@@H](CCc2nc3ccc(C(C)(C)C)cc3n2)C1 |
| InChI | InChI=1S/C30H42N8O3/c1-16(2)37(13-22-25(39)26(40)29(41-22)38-15-34-24-27(31)32-14-33-28(24)38)19-10-17(11-19)6-9-23-35-20-8-7-18(30(3,4)5)12-21(20)36-23/h7-8,12,14-17,19,22,25-26,29,39-40H,6,9-11,13H2,1-5H3,(H,35,36)(H2,31,32,33)/t17-,19+,22-,25-,26-,29-/m1/s1 |
| InChIKey | LXFOLMYKSYSZQS-LURJZOHASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinometostat (CHEBI:230493) has role antineoplastic agent (CHEBI:35610) |
| pinometostat (CHEBI:230493) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 5'-[{(1r,3S)-3-[2-(5-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl}(propan-2-yl)amino]-5'-deoxyadenosine |
| INNs | Source |
|---|---|
| pinometostat | WHO MedNet |
| pinometostat | WHO MedNet |
| pinométostat | WHO MedNet |
| pinometostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| EPZ-005676 | DrugBank |
| EPZ 5676 | DrugBank |
| EPZ-5676 | DrugBank |
| EPZ5676 | DrugBank |
| Pinometostat anhydrous | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB12920 | DrugBank |
| HMDB0256563 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1380288-87-8 | SUBMITTER |
| Citations |
|---|