EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N2O3 |
| Net Charge | +1 |
| Average Mass | 351.426 |
| Monoisotopic Mass | 351.17032 |
| SMILES | [H][C@@]12C[C@@H]3[NH+](CC[C@]34C(=Nc3ccccc34)[C@@]1(C=O)C(=O)OC)C/C2=C/C |
| InChI | InChI=1S/C21H22N2O3/c1-3-13-11-23-9-8-20-14-6-4-5-7-16(14)22-18(20)21(12-24,19(25)26-2)15(13)10-17(20)23/h3-7,12,15,17H,8-11H2,1-2H3/p+1/b13-3-/t15-,17-,20+,21-/m0/s1 |
| InChIKey | OBUYIUIFFBCOOV-OQTQPSEISA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-dehydropreakuammicine(1+) (CHEBI:230469) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| 17-dehydropreakuammicine(1+) (CHEBI:230469) is a organic cation (CHEBI:25697) |
| 17-dehydropreakuammicine(1+) (CHEBI:230469) is a organic heterotetracyclic compound (CHEBI:38163) |
| UniProt Name | Source |
|---|---|
| 17-dehydropreakuammicine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-27085 | MetaCyc |
| Citations |
|---|