EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33ClN4O8 |
| Net Charge | 0 |
| Average Mass | 541.001 |
| Monoisotopic Mass | 540.19869 |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)CCl)C(C)C |
| InChI | InChI=1S/C24H33ClN4O8/c1-12(2)21(24(37)26-13(3)22(35)28-17(10-20(33)34)19(32)11-25)29-23(36)18(27-14(4)30)9-15-5-7-16(31)8-6-15/h5-8,12-13,17-18,21,31H,9-11H2,1-4H3,(H,26,37)(H,27,30)(H,28,35)(H,29,36)(H,33,34)/t13-,17-,18-,21-/m0/s1 |
| InChIKey | UOUBHJRCKHLGFB-DGJUNBOTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.22.36 (caspase-1) inhibitor Any EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the activity of caspase-1 (EC 3.4.22.36). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has functional parent N-acetyl-L-tyrosine (CHEBI:21563) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has functional parent L-alanine (CHEBI:16977) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has functional parent L-aspartic acid (CHEBI:17053) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has functional parent L-valine (CHEBI:16414) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has role EC 3.4.22.36 (caspase-1) inhibitor (CHEBI:76795) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has role nephroprotective agent (CHEBI:76595) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) has role neuroprotective agent (CHEBI:63726) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) is a organochlorine compound (CHEBI:36683) |
| Ac-Tyr-Val-Ala-Asp-chloromethylketone (CHEBI:230455) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N-acetyl-L-tyrosyl-L-valyl-N-[(2S)-1-carboxy-4-chloro-3-oxobutan-2-yl]-L-alaninamide |
| Synonyms | Source |
|---|---|
| Ac-YVAD-cmk | ChEBI |
| Ac-L-Tyr-L-Val-L-Ala-L-Asp-chloromethylketone | ChEBI |
| N-acetyl-tyrosyl-valyl-alanyl-aspartyl chloromethyl ketone | ChEBI |
| N-acetyl-tyrosinyl-valinyl-alanyl-aspartyl chloromethyl ketone | ChEBI |
| N-acetyltyrosinylvalinylalanylaspartylchloromethyl ketone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0249697 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:178603-78-6 | ChEBI |
| Citations |
|---|