EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | C1=CCC2(CC1)COC(c1ccco1)OC2 |
| InChI | InChI=1S/C13H16O3/c1-2-6-13(7-3-1)9-15-12(16-10-13)11-5-4-8-14-11/h1-2,4-5,8,12H,3,6-7,9-10H2 |
| InChIKey | ODVKSTFPQDVPJZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ulinastatin (CHEBI:230430) has role anti-inflammatory agent (CHEBI:67079) |
| Ulinastatin (CHEBI:230430) has role antiviral agent (CHEBI:22587) |
| Ulinastatin (CHEBI:230430) has role vulnerary (CHEBI:73336) |
| Ulinastatin (CHEBI:230430) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-(uran-2-yl)-2,4-dioxaspiro[5.5]undec-9-ene |
| INNs | Source |
|---|---|
| ulinastatina | WHO MedNet |
| ulinastatine | WHO MedNet |
| Synonyms | Source |
|---|---|
| AER-002 | ChEMBL |
| Bikunin | ChEMBL |
| Estotin | ChEMBL |
| Mingin | ChEMBL |
| Miraclid | ChEMBL |
| Trypsin inhibitor uti-1 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 94826 | ChemSpider |
| D77201 | KEGG DRUG |
| HMDB0259397 | HMDB |