EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO4 |
| Net Charge | 0 |
| Average Mass | 229.276 |
| Monoisotopic Mass | 229.13141 |
| SMILES | C/C=C/C(=O)C(O)(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C11H19NO4/c1-5-6-9(13)11(16,7-10(14)15)8-12(2,3)4/h5-6,16H,7-8H2,1-4H3/b6-5+ |
| InChIKey | FKLSJDGSSFEPLD-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butenoylcarnitine (CHEBI:230404) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (E)-3-hydroxy-4-oxo-3-[(trimethylazaniumyl)methyl]hept-5-enoate |
| Manual Xrefs | Databases |
|---|---|
| 128530433 | ChemSpider |