EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34N6O7S |
| Net Charge | 0 |
| Average Mass | 574.660 |
| Monoisotopic Mass | 574.22097 |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N2CCCC2C(=O)NC(CCCCN)C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H34N6O7S/c1-18-7-13-21(14-8-18)40(38,39)28-17-24(33)31-16-4-6-23(31)26(35)30-22(5-2-3-15-27)25(34)29-19-9-11-20(12-10-19)32(36)37/h7-14,22-23,28H,2-6,15-17,27H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | PEHDMKYTTRTXSH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chromozym PL (CHEBI:230402) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[6-amino-1-(4-nitroanilino)-1-oxohexan-2-yl]-1-[2-[(4-methylphenyl)sulonylamino]acetyl]pyrrolidine-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| HMDB0250215 | HMDB |
| 3380693 | ChemSpider |