EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O4S |
| Net Charge | 0 |
| Average Mass | 370.430 |
| Monoisotopic Mass | 370.09873 |
| SMILES | CCOc1ccc(-c2nc(-c3cccc(C(=O)O)n3)cs2)cc1OCC |
| InChI | InChI=1S/C19H18N2O4S/c1-3-24-16-9-8-12(10-17(16)25-4-2)18-21-15(11-26-18)13-6-5-7-14(20-13)19(22)23/h5-11H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | XDBHURGONHZNJF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tetomilast (CHEBI:230391) is a aromatic carboxylic acid (CHEBI:33859) |
| Tetomilast (CHEBI:230391) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 6-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]pyridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2291461 | ChemSpider |
| DB05298 | DrugBank |
| HMDB0258864 | HMDB |