EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N4O3 |
| Net Charge | 0 |
| Average Mass | 254.290 |
| Monoisotopic Mass | 254.13789 |
| SMILES | O=[N+]([O-])c1nccn1CC(O)CN1CCCCC1 |
| InChI | InChI=1S/C11H18N4O3/c16-10(8-13-5-2-1-3-6-13)9-14-7-4-12-11(14)15(17)18/h4,7,10,16H,1-3,5-6,8-9H2 |
| InChIKey | WVWOOAYQYLJEFD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pimonidazole (CHEBI:230386) has role antineoplastic agent (CHEBI:35610) |
| Pimonidazole (CHEBI:230386) has role antitubercular agent (CHEBI:33231) |
| Pimonidazole (CHEBI:230386) has role cardiovascular drug (CHEBI:35554) |
| Pimonidazole (CHEBI:230386) is a C-nitro compound (CHEBI:35716) |
| IUPAC Name |
|---|
| 1-(2-nitroimidazol-1-yl)-3-piperidin-1-ylpropan-2-ol |
| INNs | Source |
|---|---|
| pimonidazol | WHO MedNet |
| pimonidazole | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-380540 | ChEMBL |
| PD 126675 | ChEMBL |
| PD-126675 | ChEMBL |
| RO 03-8799 | ChEMBL |
| RO-03-8799 | ChEMBL |
| RO-038799 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 46214 | ChemSpider |
| DB12485 | DrugBank |
| HMDB0256554 | HMDB |
| Citations |
|---|