EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO5 |
| Net Charge | 0 |
| Average Mass | 271.313 |
| Monoisotopic Mass | 271.14197 |
| SMILES | CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C13H21NO5/c1-5-18-11(16)9-6-7-14(8-10(9)15)12(17)19-13(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | WCTXJAXKORIYNA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Tert-Butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate (CHEBI:230366) is a carboxylic acid (CHEBI:33575) |
| 1-Tert-Butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate (CHEBI:230366) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 1-O-tert-butyl 4-O-ethyl 3-oxopiperidine-1,4-dicarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 13336014 | ChemSpider |
| HMDB0247311 | HMDB |