EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H80NO11P |
| Net Charge | 0 |
| Average Mass | 878.138 |
| Monoisotopic Mass | 877.54690 |
| SMILES | CC/C=C\CC(O)/C=C/C=C/C/C=C\C/C=C\C/C=C\CCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C48H80NO11P/c1-3-5-7-8-9-10-11-12-13-14-15-18-21-24-27-30-34-38-46(51)57-40-44(41-58-61(55,56)59-42-45(49)48(53)54)60-47(52)39-35-31-28-25-22-19-16-17-20-23-26-29-33-37-43(50)36-32-6-4-2/h6,12-13,17,19-20,22,26,28-29,31-33,37,43-45,50H,3-5,7-11,14-16,18,21,23-25,27,30,34-36,38-42,49H2,1-2H3,(H,53,54)(H,55,56)/b13-12-,20-17-,22-19-,29-26+,31-28-,32-6-,37-33+/t43?,44-,45+/m1/s1 |
| InChIKey | OWAIOEZGWBNCFH-KRDAMSAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS(20:1(11Z)/22:6(4Z,7Z,10Z,13E,15E,19Z)-OH(17)) (CHEBI:230358) is a phosphatidyl-L-serine (CHEBI:18303) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[hydroxy-[(2R)-2-[(4Z,7Z,10Z,13E,15E,19Z)-17-hydroxydocosa-4,7,10,13,15,19-hexaenoyl]oxy-3-[(Z)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0282231 | HMDB |