EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O6 |
| Net Charge | 0 |
| Average Mass | 332.312 |
| Monoisotopic Mass | 332.10084 |
| SMILES | O=C(O)CNC(=O)c1c(O)c2ccccc2n(OCC2CC2)c1=O |
| InChI | InChI=1S/C16H16N2O6/c19-12(20)7-17-15(22)13-14(21)10-3-1-2-4-11(10)18(16(13)23)24-8-9-5-6-9/h1-4,9,21H,5-8H2,(H,17,22)(H,19,20) |
| InChIKey | IKRKQQLJYBAPQT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Desidustat (CHEBI:230352) has role antiviral agent (CHEBI:22587) |
| Desidustat (CHEBI:230352) has role renoprotective agent (CHEBI:231911) |
| Desidustat (CHEBI:230352) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[1-(cyclopropylmethoxy)-4-hydroxy-2-oxoquinoline-3-carbonyl]amino]acetic acid |
| INN | Source |
|---|---|
| desidustat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Zyan-1 | ChEMBL |
| ZYAN1 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 64835241 | ChemSpider |
| D80699 | KEGG DRUG |
| DB16135 | DrugBank |
| HMDB0251046 | HMDB |