EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCCc1ccc(CCCCCCCCC(=O)O)o1 |
| InChI | InChI=1S/C18H30O3/c1-2-3-8-11-16-14-15-17(21-16)12-9-6-4-5-7-10-13-18(19)20/h14-15H,2-13H2,1H3,(H,19,20) |
| InChIKey | BJTONYHCPUUWFX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-pentyl-2-furannonanoic acid (CHEBI:230348) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 9-(5-pentyluran-2-yl)nonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 26323995 | ChemSpider |
| HMDB0112102 | HMDB |
| LMFA01150042 | LIPID MAPS |