EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H51N5O6 |
| Net Charge | 0 |
| Average Mass | 661.844 |
| Monoisotopic Mass | 661.38393 |
| SMILES | CCC(C)C1NC(=O)C2C(CCN2C(=O)C(CC(C)C)NC(=O)C(Cc2ccccc2)N(C)C)Oc2ccc(OC)c(c2)/C=C/NC1=O |
| InChI | InChI=1S/C37H51N5O6/c1-8-24(4)32-35(44)38-18-16-26-22-27(14-15-30(26)47-7)48-31-17-19-42(33(31)36(45)40-32)37(46)28(20-23(2)3)39-34(43)29(41(5)6)21-25-12-10-9-11-13-25/h9-16,18,22-24,28-29,31-33H,8,17,19-21H2,1-7H3,(H,38,44)(H,39,43)(H,40,45)/b18-16+ |
| InChIKey | YTPWZBXRZAQHQB-FBMGVBCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mucronine D (CHEBI:230305) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| N-[1-[(13E)-10-butan-2-yl-16-methoxy-8,11-dioxo-2-oxa-6,9,12-triazatricyclo[13.3.1.03,7]nonadeca-1(19),13,15,17-tetraen-6-yl]-4-methyl-1-oxopentan-2-yl]-2-(dimethylamino)-3-phenylpropanamide |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029335 | HMDB |
| 35032853 | ChemSpider |