EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O3 |
| Net Charge | 0 |
| Average Mass | 460.743 |
| Monoisotopic Mass | 460.39165 |
| SMILES | CC(C)(O)C1CCC(C)(C2CCC3(C)C2CCC2C4(C)CCC(O)C(C)(C)C4CCC23C)O1 |
| InChI | InChI=1S/C30H52O3/c1-25(2)21-12-17-29(7)22(27(21,5)15-13-23(25)31)10-9-19-20(11-16-28(19,29)6)30(8)18-14-24(33-30)26(3,4)32/h19-24,31-32H,9-18H2,1-8H3 |
| InChIKey | RQBNSDSKUAGBOI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ocotillol (CHEBI:230298) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| 17-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 3075678 | ChemSpider |
| HMDB0255888 | HMDB |