EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40N2O3 |
| Net Charge | 0 |
| Average Mass | 392.584 |
| Monoisotopic Mass | 392.30389 |
| SMILES | O=C(O)CCCCCCCCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H40N2O3/c26-21(27)10-8-6-4-2-1-3-5-7-9-11-24-22(28)25-23-15-18-12-19(16-23)14-20(13-18)17-23/h18-20H,1-17H2,(H,26,27)(H2,24,25,28) |
| InChIKey | XLGSEOAVLVTJDH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AUDA (CHEBI:230291) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 12-(1-adamantylcarbamoylamino)dodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8244657 | ChemSpider |
| D81052 | KEGG DRUG |
| HMDB0248721 | HMDB |