EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O5 |
| Net Charge | 0 |
| Average Mass | 450.660 |
| Monoisotopic Mass | 450.33452 |
| SMILES | C[C@H](CCC(=O)C(C)(C)O)[C@H]1CC[C@@H]2[C@@H]3[C@@H](C[C@@H](O)[C@@]21C)[C@]1(C)CC[C@H](O)C[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C27H46O5/c1-15(6-9-22(30)25(2,3)32)18-7-8-19-24-20(14-23(31)27(18,19)5)26(4)11-10-17(28)12-16(26)13-21(24)29/h15-21,23-24,28-29,31-32H,6-14H2,1-5H3/t15-,16-,17+,18-,19-,20-,21+,23-,24-,26-,27-/m1/s1 |
| InChIKey | CFVCOEMVLNMDAX-AHYZLEOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha,7alpha,12alpha,25-Tetrahydroxy-5beta-cholestane-24-one (CHEBI:230259) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (6R)-2-hydroxy-2-methyl-6-[(3S,5R,7S,8S,9R,10R,12R,13R,14R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060137 | HMDB |
| 30778550 | ChemSpider |