EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O3 |
| Net Charge | 0 |
| Average Mass | 244.335 |
| Monoisotopic Mass | 244.17869 |
| SMILES | CCCCCC(=O)C(N)CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H24N2O3/c1-2-3-4-8-11(15)9(13)6-5-7-10(14)12(16)17/h9-10H,2-8,13-14H2,1H3,(H,16,17)/t9?,10-/m0/s1 |
| InChIKey | CBVKLEOGWBFWFG-AXDSSHIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epsilon-(Hexanoyl)lysine (CHEBI:230253) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2,6-diamino-7-oxododecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 18723985 | ChemSpider |