EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O9 |
| Net Charge | 0 |
| Average Mass | 502.560 |
| Monoisotopic Mass | 502.22028 |
| SMILES | [H][C@@]12C=C(C)CC[C@@]13COC(=O)[C@@H](O)[C@H](C)CCOC(=O)/C=C/C=C\C(=O)O[C@@H]1C[C@@]([H])(O2)[C@@]2(CO2)[C@]13C |
| InChI | InChI=1S/C27H34O9/c1-16-8-10-26-14-33-24(31)23(30)17(2)9-11-32-21(28)6-4-5-7-22(29)36-18-13-20(35-19(26)12-16)27(15-34-27)25(18,26)3/h4-7,12,17-20,23,30H,8-11,13-15H2,1-3H3/b6-4+,7-5-/t17-,18-,19-,20-,23+,25-,26-,27+/m1/s1 |
| InChIKey | NLUGUZJQJYVUHS-IDXDZYHTSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verrucarin A (CHEBI:230243) is a epoxide (CHEBI:32955) |
| verrucarin A (CHEBI:230243) is a macrolide antibiotic (CHEBI:25105) |
| verrucarin A (CHEBI:230243) is a macrotriolide (CHEBI:145559) |
| verrucarin A (CHEBI:230243) is a organic heterotetracyclic compound (CHEBI:38163) |
| verrucarin A (CHEBI:230243) is a trichothecene (CHEBI:55517) |
| IUPAC Name |
|---|
| (4S,5R,10E,12Z,16R,16aS,17S,18R,19aR,23aR)-4-hydroxy-5,16a,21-trimethyl-4,5,6,7,16,16a,22,23-octahydro-3H,18H,19aH-spiro[16,18-methano[1,6,12]trioxacyclooctadecino[3,4-d]chromene-17,2'-oxirane]-3,9,14-trione |
| Synonyms | Source |
|---|---|
| Verrucarin A | KEGG COMPOUND |
| Muconomycin A | KEGG COMPOUND |