EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36NO5P |
| Net Charge | 0 |
| Average Mass | 401.484 |
| Monoisotopic Mass | 401.23311 |
| SMILES | CCCCCCCCc1ccc(CCCC(N)(CO)COP(=O)(O)O)cc1 |
| InChI | InChI=1S/C20H36NO5P/c1-2-3-4-5-6-7-9-18-11-13-19(14-12-18)10-8-15-20(21,16-22)17-26-27(23,24)25/h11-14,22H,2-10,15-17,21H2,1H3,(H2,23,24,25) |
| InChIKey | DQKSVFVIWBOSPM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [2-Amino-2-(hydroxymethyl)-5-(4-octylphenyl)pentyl] dihydrogen phosphate (CHEBI:230224) is a benzenes (CHEBI:22712) |
| [2-Amino-2-(hydroxymethyl)-5-(4-octylphenyl)pentyl] dihydrogen phosphate (CHEBI:230224) is a organic amino compound (CHEBI:50047) |
| IUPAC Name |
|---|
| [2-amino-2-(hydroxymethyl)-5-(4-octylphenyl)pentyl] dihydrogen phosphate |
| Manual Xrefs | Databases |
|---|---|
| 24627493 | ChemSpider |
| HMDB0252505 | HMDB |