EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H80NO11P |
| Net Charge | 0 |
| Average Mass | 878.138 |
| Monoisotopic Mass | 877.54690 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C/C(O)C/C=C\CCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C48H80NO11P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-34-38-46(51)57-40-44(41-58-61(55,56)59-42-45(49)48(53)54)60-47(52)39-35-31-33-37-43(50)36-32-29-27-25-23-21-16-14-12-10-8-6-4-2/h6,8,12,14,17-18,21,23,27,29,31-33,36,43-45,50H,3-5,7,9-11,13,15-16,19-20,22,24-26,28,30,34-35,37-42,49H2,1-2H3,(H,53,54)(H,55,56)/b8-6-,14-12-,18-17-,23-21-,29-27-,33-31-,36-32-/t43?,44-,45+/m1/s1 |
| InChIKey | DUKLFBFMEKALNJ-SVZALANUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS(20:1(11Z)/22:6(4Z,8Z,10Z,13Z,16Z,19Z)-OH(7)) (CHEBI:230193) is a phosphatidyl-L-serine (CHEBI:18303) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[hydroxy-[(2R)-2-[(4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoyl]oxy-3-[(Z)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0282227 | HMDB |