EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CCCCCCCCC(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-9-12-15(17)13-10-7-8-11-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19) |
| InChIKey | KMEKMXBMYZGGDT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Hydroxyhexadecanoic acid (CHEBI:230116) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 8-hydroxyhexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13662332 | ChemSpider |
| HMDB0112186 | HMDB |
| LMFA01050541 | LIPID MAPS |