EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H4D10N2O4 |
| Net Charge | 0 |
| Average Mass | 272.326 |
| Monoisotopic Mass | 272.15812 |
| SMILES | [2H]c1c([2H])c(N(C([2H])([2H])[2H])C([2H])([2H])[2H])c([2H])c([2H])c1C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H14N2O4/c1-14(2)10-5-3-9(4-6-10)13(18)19-15-11(16)7-8-12(15)17/h3-6H,7-8H2,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChIKey | FNGFZOAQGYOQTG-ZGYYUIRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DMABA-d10 NHS ester (CHEBI:230062) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| (2,5-dioxopyrrolidin-1-yl) 4-[bis(trideuteriomethyl)amino]-2,3,5,6-tetradeuteriobenzoate |
| Manual Xrefs | Databases |
|---|---|
| 29341835 | ChemSpider |