EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O3 |
| Net Charge | 0 |
| Average Mass | 204.225 |
| Monoisotopic Mass | 204.07864 |
| SMILES | CC(=O)/C(=C\c1ccccc1)CC(=O)O |
| InChI | InChI=1S/C12H12O3/c1-9(13)11(8-12(14)15)7-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,14,15)/b11-7- |
| InChIKey | BNQYXFAVUMPZFG-XFFZJAGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LEVULINIC ACID, 3-BENZYLIDENYL- (CHEBI:230048) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (3Z)-3-benzylidene-4-oxopentanoic acid |