EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53N7O9 |
| Net Charge | 0 |
| Average Mass | 703.838 |
| Monoisotopic Mass | 703.39048 |
| SMILES | CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C(Cc2ccccc2)NC(=O)C(C(C)O)NC(=O)CNC(=O)C(C(C)O)NC(=O)C(C)NC1=O |
| InChI | InChI=1S/C34H53N7O9/c1-8-18(4)26-33(49)36-19(5)29(45)41-27(20(6)42)32(48)35-16-25(44)39-28(21(7)43)34(50)38-24(15-22-12-10-9-11-13-22)30(46)37-23(14-17(2)3)31(47)40-26/h9-13,17-21,23-24,26-28,42-43H,8,14-16H2,1-7H3,(H,35,48)(H,36,49)(H,37,46)(H,38,50)(H,39,44)(H,40,47)(H,41,45) |
| InChIKey | LZVXYGLCVNPQDY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Citrusin I (CHEBI:230031) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 15-benzyl-9-butan-2-yl-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| Manual Xrefs | Databases |
|---|---|
| 57462402 | ChemSpider |
| HMDB0303680 | HMDB |