EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H39N7O5 |
| Net Charge | 0 |
| Average Mass | 565.675 |
| Monoisotopic Mass | 565.30127 |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1C(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H39N7O5/c30-21(17-19-9-3-1-4-10-19)25(37)35-23(18-20-11-5-2-6-12-20)27(39)36-16-8-14-24(36)26(38)34-22(28(40)41)13-7-15-33-29(31)32/h1-6,9-12,21-24H,7-8,13-18,30H2,(H,34,38)(H,35,37)(H,40,41)(H4,31,32,33) |
| InChIKey | ANAFHSULEWIOPZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Phe-Pro-Arg (CHEBI:230030) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[1-[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0304807 | HMDB |
| 16685227 | ChemSpider |