EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N |
| Net Charge | 0 |
| Average Mass | 135.210 |
| Monoisotopic Mass | 135.10480 |
| SMILES | CN[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/m0/s1 |
| InChIKey | RCSSHZGQHHEHPZ-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(-)-N,alpha-Dimethylbenzylamine (CHEBI:230020) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (1S)-N-methyl-1-phenylethanamine |
| Manual Xrefs | Databases |
|---|---|
| 1552779 | ChemSpider |