EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18NO7P |
| Net Charge | 0 |
| Average Mass | 331.261 |
| Monoisotopic Mass | 331.08209 |
| SMILES | COP(=O)(CCC(N)C(=O)O)Oc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C13H18NO7P/c1-20-22(19,6-5-11(14)13(17)18)21-10-4-2-3-9(7-10)8-12(15)16/h2-4,7,11H,5-6,8,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | NTFPDEDRMYYPAC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS9100) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ggstop (CHEBI:230017) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-4-[[3-(carboxymethyl)phenoxy]-methoxyphosphoryl]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30774259 | ChemSpider |
| HMDB0252708 | HMDB |