EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | O=C(O)/C=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C9H8O5/c10-6-3-1-5(2-4-7(11)12)8(13)9(6)14/h1-4,10,13-14H,(H,11,12)/b4-2+ |
| InChIKey | RHGWNBSOWGUGPA-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-3-(2,3,4-trihydroxyphenyl)prop-2-enoic acid (CHEBI:229988) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(2,3,4-trihydroxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10637353 | ChemSpider |