EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O5 |
| Net Charge | 0 |
| Average Mass | 182.131 |
| Monoisotopic Mass | 182.02152 |
| SMILES | O=C(O)c1cc(O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O5/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | QNVNLUSHGRBCLO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxyisophthalic acid (CHEBI:229984) is a 2-hydroxyisophthalic acid (CHEBI:19643) |
| IUPAC Name |
|---|
| 5-hydroxybenzene-1,3-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 62470 | ChemSpider |