EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8N2O2 |
| Net Charge | 0 |
| Average Mass | 176.175 |
| Monoisotopic Mass | 176.05858 |
| SMILES | N#Cc1ccc(NCC(=O)O)cc1 |
| InChI | InChI=1S/C9H8N2O2/c10-5-7-1-3-8(4-2-7)11-6-9(12)13/h1-4,11H,6H2,(H,12,13) |
| InChIKey | KJRQMXRCZULRHF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-Cyanophenyl)glycine (CHEBI:229983) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-(4-cyanoanilino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 714611 | ChemSpider |