EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C62H110N11O15S |
| Net Charge | -1 |
| Average Mass | 1281.691 |
| Monoisotopic Mass | 1280.79091 |
| SMILES | C/C=C/C[C@@H](C)[C@@H](OS(=O)(=O)[O-])[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)CC(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C62H111N11O15S/c1-25-27-28-40(15)52(88-89(85,86)87)51-56(78)65-43(26-2)58(80)67(18)33-48(74)68(19)44(29-34(3)4)55(77)66-49(38(11)12)61(83)69(20)45(30-35(5)6)54(76)63-41(16)53(75)64-42(17)57(79)70(21)46(31-36(7)8)59(81)71(22)47(32-37(9)10)60(82)72(23)50(39(13)14)62(84)73(51)24/h25,27,34-47,49-52H,26,28-33H2,1-24H3,(H,63,76)(H,64,75)(H,65,78)(H,66,77)(H,85,86,87)/p-1/b27-25+/t40-,41+,42-,43+,44+,45+,46+,47+,49+,50+,51+,52-/m1/s1 |
| InChIKey | CQDXGGWUGMQJHS-CGLBZJNRSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000118) | PubMed (2316020) | ||
| bile (BTO:0000121) | PubMed (2316020) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclosporin A sulfate (CHEBI:229978) has role drug metabolite (CHEBI:49103) |
| cyclosporin A sulfate (CHEBI:229978) has role human xenobiotic metabolite (CHEBI:76967) |
| cyclosporin A sulfate (CHEBI:229978) is a organosulfate oxoanion (CHEBI:58958) |
| cyclosporin A sulfate (CHEBI:229978) is conjugate base of cyclosporin A hydrogen sulfate (CHEBI:230454) |
| Incoming Relation(s) |
| cyclosporin A hydrogen sulfate (CHEBI:230454) is conjugate acid of cyclosporin A sulfate (CHEBI:229978) |
| IUPAC Name |
|---|
| (1R,2R,4E)-1-[(2S,5S,11S,14S,17S,20S,23R,26S,29S,32S)-5-ethyl-1,7,10,16,20,23,25,28,31-nonamethyl-11,17,26,29-tetrakis(2-methylpropyl)-3,6,9,12,15,18,21,24,27,30,33-undecaoxo-14,32-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2-yl]-2-methylhex-4-en-1-yl sulfate |
| Synonyms | Source |
|---|---|
| CsA-SO4 | SUBMITTER |
| cyclosporin A sulfate (ester) | ChEBI |
| cyclosporin A sulphate | ChEBI |
| cyclosporine sulfate | ChEBI |
| Citations |
|---|