EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H35N3O2 |
| Net Charge | 0 |
| Average Mass | 505.662 |
| Monoisotopic Mass | 505.27293 |
| SMILES | CC(C)NCC(O)COC(Cn1c2ccccc2c2ccccc21)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C33H35N3O2/c1-23(2)34-19-24(37)22-38-25(20-35-30-15-7-3-11-26(30)27-12-4-8-16-31(27)35)21-36-32-17-9-5-13-28(32)29-14-6-10-18-33(29)36/h3-18,23-25,34,37H,19-22H2,1-2H3 |
| InChIKey | BLTONWSCODZCNA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.1.1.37 [DNA (cytosine-5-)-methyltransferase] inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of DNA (cytosine-5-)-methyltransferase (EC 2.1.1.37). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DC_517 (CHEBI:229971) has role antineoplastic agent (CHEBI:35610) |
| DC_517 (CHEBI:229971) has role apoptosis inducer (CHEBI:68495) |
| DC_517 (CHEBI:229971) has role EC 2.1.1.37 [DNA (cytosine-5-)-methyltransferase] inhibitor (CHEBI:90190) |
| DC_517 (CHEBI:229971) is a carbazoles (CHEBI:48513) |
| DC_517 (CHEBI:229971) is a ether (CHEBI:25698) |
| DC_517 (CHEBI:229971) is a secondary alcohol (CHEBI:35681) |
| DC_517 (CHEBI:229971) is a secondary amino compound (CHEBI:50995) |
| DC_517 (CHEBI:229971) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-{[1,3-di(9H-carbazol-9-yl)propan-2-yl]oxy}-3-(propan-2-ylamino)propan-2-ol |
| Synonyms | Source |
|---|---|
| DC 517 | ChEBI |
| DC-517 | SUBMITTER |
| DC517 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:500017-70-9 | ChEBI |
| Citations |
|---|