EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N4O3 |
| Net Charge | 0 |
| Average Mass | 478.637 |
| Monoisotopic Mass | 478.29439 |
| SMILES | COc1cc2c(NC3CCN(C)CC3)cc(-c3ccc(C)o3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C28H38N4O3/c1-20-7-8-26(35-20)25-18-23(29-21-9-14-31(2)15-10-21)22-17-27(33-3)28(19-24(22)30-25)34-16-6-13-32-11-4-5-12-32/h7-8,17-19,21H,4-6,9-16H2,1-3H3,(H,29,30) |
| InChIKey | RLQLKZTYUYIWDB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.1.1.43 (enhancer of zeste homolog 2) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of Enhancer of zeste homolog 2 (EZH2), a histone-lysine N-methyltransferase (EC 2.1.1.43). EC 2.1.1.37 [DNA (cytosine-5-)-methyltransferase] inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of DNA (cytosine-5-)-methyltransferase (EC 2.1.1.37). ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CM-272 (CHEBI:229970) has role antineoplastic agent (CHEBI:35610) |
| CM-272 (CHEBI:229970) has role apoptosis inducer (CHEBI:68495) |
| CM-272 (CHEBI:229970) has role EC 2.1.1.37 [DNA (cytosine-5-)-methyltransferase] inhibitor (CHEBI:90190) |
| CM-272 (CHEBI:229970) has role EC 2.1.1.43 (enhancer of zeste homolog 2) inhibitor (CHEBI:167694) |
| CM-272 (CHEBI:229970) has role ferroptosis inducer (CHEBI:173085) |
| CM-272 (CHEBI:229970) is a N-alkylpyrrolidine (CHEBI:46775) |
| CM-272 (CHEBI:229970) is a aminoquinoline (CHEBI:36709) |
| CM-272 (CHEBI:229970) is a aromatic ether (CHEBI:35618) |
| CM-272 (CHEBI:229970) is a diether (CHEBI:46786) |
| CM-272 (CHEBI:229970) is a furans (CHEBI:24129) |
| CM-272 (CHEBI:229970) is a piperidines (CHEBI:26151) |
| CM-272 (CHEBI:229970) is a secondary amino compound (CHEBI:50995) |
| CM-272 (CHEBI:229970) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6-methoxy-2-(5-methylfuran-2-yl)-N-(1-methylpiperidin-4-yl)-7-[3-(pyrrolidin-1-yl)propoxy]quinolin-4-amine |
| Synonyms | Source |
|---|---|
| 6-methoxy-2-(5-methyl-2-furanyl)-N-(1-methyl-4-piperidinyl)-7-[3-(1-pyrrolidinyl)propoxy]-4-quinolinamine | ChEBI |
| CM 272 | ChEBI |
| CM272 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1846570-31-7 | ChEBI |
| Citations |
|---|