EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O4 |
| Net Charge | 0 |
| Average Mass | 348.358 |
| Monoisotopic Mass | 348.11101 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C20H16N2O4/c1-2-20(25)14-8-16-17-12(7-11-5-3-4-6-15(11)21-17)9-22(16)18(23)13(14)10-26-19(20)24/h3-8,25H,2,9-10H2,1H3/t20-/m0/s1 |
| InChIKey | VSJKWCGYPAHWDS-FQEVSTJZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camptotheca acuminata (ncbitaxon:16922) | xylem (BTO:0001468) | PubMed (21348469) | Previous component: wood; |
| Fusarium solani (ncbitaxon:169388) | - | PubMed (21348469) | Endophytic fungus isolated from inner bark of Camptotheca acuminata Strain: INFU/Ca/KF/3 |
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camptothecin (CHEBI:27656) has role antineoplastic agent (CHEBI:35610) |
| camptothecin (CHEBI:27656) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| camptothecin (CHEBI:27656) has role genotoxin (CHEBI:50902) |
| camptothecin (CHEBI:27656) has role plant metabolite (CHEBI:76924) |
| camptothecin (CHEBI:27656) is a pyranoindolizinoquinoline (CHEBI:48626) |
| camptothecin (CHEBI:27656) is a quinoline alkaloid (CHEBI:26509) |
| camptothecin (CHEBI:27656) is a tertiary alcohol (CHEBI:26878) |
| camptothecin (CHEBI:27656) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4S)-4-ethyl-4-hydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| Synonyms | Source |
|---|---|
| 20(S)-camptothecine | ChemIDplus |
| 21,22-Secocamptothecin-21-oic acid lactone | ChemIDplus |
| (+)-camptothecin | DrugBank |
| Camptothecin | KEGG COMPOUND |
| (+)-camptothecine | DrugBank |
| Camptothecine | ChemIDplus |
| Citations |
|---|