EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:229963 - DMH4
| Formula | C24H24N4O2 |
| Net Charge | 0 |
| Average Mass | 400.482 |
| Monoisotopic Mass | 400.18993 |
| SMILES | c1ccc(-c2cnn3cc(-c4ccc(OCCN5CCOCC5)cc4)cnc23)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-2-4-20(5-3-1)23-17-26-28-18-21(16-25-24(23)28)19-6-8-22(9-7-19)30-15-12-27-10-13-29-14-11-27/h1-9,16-18H,10-15H2 |
| InChIKey | SKZQZGSPYYHTQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DMH4 (CHEBI:229963) has role angiogenesis inhibitor (CHEBI:48422) |
| DMH4 (CHEBI:229963) has role antineoplastic agent (CHEBI:35610) |
| DMH4 (CHEBI:229963) has role apoptosis inducer (CHEBI:68495) |
| DMH4 (CHEBI:229963) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| DMH4 (CHEBI:229963) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| DMH4 (CHEBI:229963) is a aromatic ether (CHEBI:35618) |
| DMH4 (CHEBI:229963) is a benzenes (CHEBI:22712) |
| DMH4 (CHEBI:229963) is a morpholines (CHEBI:38785) |
| DMH4 (CHEBI:229963) is a pyrazolopyrimidine (CHEBI:38669) |
| DMH4 (CHEBI:229963) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6-{4-[2-(morpholin-4-yl)ethoxy]phenyl}-3-phenylpyrazolo[1,5-a]pyrimidine |
| Synonyms | Source |
|---|---|
| DMH 4 | ChEBI |
| 6-[4-[2-(4-morpholinyl)ethoxy]phenyl]-3-phenyl-pyrazolo[1,5-a]pyrimidine | ChEBI |
| 3-phenyl-6-[4-(2-morpholinoethoxy)phenyl]pyrazolo[1,5-a]pyrimidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:515880-75-8 | ChEBI |
| Citations |
|---|