EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N6 |
| Net Charge | 0 |
| Average Mass | 406.493 |
| Monoisotopic Mass | 406.19059 |
| SMILES | c1cc(-c2cnn3cc(-c4ccc(N5CCNCC5)cc4)cnc23)c2cccnc2c1 |
| InChI | InChI=1S/C25H22N6/c1-3-21(22-4-2-10-27-24(22)5-1)23-16-29-31-17-19(15-28-25(23)31)18-6-8-20(9-7-18)30-13-11-26-12-14-30/h1-10,15-17,26H,11-14H2 |
| InChIKey | BBDGBGOVJPEFBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.30 (receptor protein serine/threonine kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the activity of receptor protein serine/threonine kinase (EC 2.7.11.30). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LDN-212854 (CHEBI:229962) has role angiogenesis inhibitor (CHEBI:48422) |
| LDN-212854 (CHEBI:229962) has role antineoplastic agent (CHEBI:35610) |
| LDN-212854 (CHEBI:229962) has role EC 2.7.11.30 (receptor protein serine/threonine kinase) inhibitor (CHEBI:137123) |
| LDN-212854 (CHEBI:229962) is a N-arylpiperazine (CHEBI:46848) |
| LDN-212854 (CHEBI:229962) is a pyrazolopyrimidine (CHEBI:38669) |
| LDN-212854 (CHEBI:229962) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 5-{6-[4-(piperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl}quinoline |
| Synonyms | Source |
|---|---|
| LDN212854 | ChEBI |
| LDN 212854 | ChEBI |
| 5-[6-[4-(1-piperazinyl)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]-quinoline | ChEBI |
| Citations |
|---|