EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N5O3 |
| Net Charge | +1 |
| Average Mass | 232.264 |
| Monoisotopic Mass | 232.14042 |
| SMILES | NC(=[NH2+])NCCC[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C8H17N5O3/c9-5(2-1-3-12-8(10)11)7(16)13-4-6(14)15/h5H,1-4,9H2,(H,13,16)(H,14,15)(H4,10,11,12)/p+1/t5-/m0/s1 |
| InChIKey | XUUXCWCKKCZEAW-YFKPBYRVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Gly(1+) (CHEBI:229955) is a L-arginyl-L-α-amino acid(1+) (CHEBI:84315) |
| Arg-Gly(1+) (CHEBI:229955) is conjugate acid of Arg-Gly (CHEBI:157792) |
| Incoming Relation(s) |
| Arg-Gly (CHEBI:157792) is conjugate base of Arg-Gly(1+) (CHEBI:229955) |
| IUPAC Name |
|---|
| {[(2S)-5-{[amino(iminio)methyl]amino}-2-azaniumylpentanoyl]amino}acetate |
| Synonyms | Source |
|---|---|
| R-G cation | ChEBI |
| RG cation | ChEBI |
| L-arginylglycine(1+) | ChEBI |
| L-arginylglycine cation | ChEBI |
| UniProt Name | Source |
|---|---|
| L-arginyl-glycine | UniProt |
| Citations |
|---|