EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O3 |
| Net Charge | 0 |
| Average Mass | 460.743 |
| Monoisotopic Mass | 460.39165 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H52O3/c1-19(9-13-25(32)27(4,5)33)20-15-16-30(8)23-12-10-21-22(11-14-24(31)26(21,2)3)28(23,6)17-18-29(20,30)7/h10,19-20,22-25,31-33H,9,11-18H2,1-8H3/t19-,20-,22-,23-,24+,25-,28+,29-,30+/m1/s1 |
| InChIKey | RLNPYPMNPJGLNJ-KBHKVJMNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24R)-24,25-dihydroxycucurbitadienol (CHEBI:229950) has functional parent (24S)-24,25-epoxycucurbitadienol (CHEBI:229949) |
| (24R)-24,25-dihydroxycucurbitadienol (CHEBI:229950) has role plant metabolite (CHEBI:76924) |
| (24R)-24,25-dihydroxycucurbitadienol (CHEBI:229950) is a tetracyclic triterpenoid (CHEBI:26893) |
| UniProt Name | Source |
|---|---|
| (24R)-24,25-dihydroxycucurbitadienol | UniProt |
| Citations |
|---|