EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O3 |
| Net Charge | 0 |
| Average Mass | 228.292 |
| Monoisotopic Mass | 228.14739 |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C11H20N2O3/c1-8(13(2,3)4)10(14)12-7-5-6-9(12)11(15)16/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | KXONJPJIFNGMCN-IUCAKERBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS9394) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N,N-Trimethyl-L-alanyl-L-proline betaine (TMAP) (CHEBI:229948) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-(trimethylazaniumyl)propanoyl]pyrrolidine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0240365 | HMDB |
| Citations |
|---|