EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | CC1=C2C/C=C(/C)CCC/C(C)=C\CC(CC1)C2(C)C |
| InChI | InChI=1S/C20H32/c1-15-7-6-8-16(2)10-14-19-17(3)11-13-18(12-9-15)20(19,4)5/h9-10,18H,6-8,11-14H2,1-5H3/b15-9-,16-10- |
| InChIKey | PCIXTRZRJQICOW-VULZFCBJSA-N |
| Roles Classification |
|---|
| Biological Role: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sobralene (CHEBI:229939) has role pheromone (CHEBI:26013) |
| sobralene (CHEBI:229939) is a diterpene (CHEBI:35190) |
| UniProt Name | Source |
|---|---|
| sobralene | UniProt |
| Citations |
|---|