EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N6O3 |
| Net Charge | 0 |
| Average Mass | 382.424 |
| Monoisotopic Mass | 382.17534 |
| SMILES | CC(C)n1ncnc1-c1cn2c(n1)-c1ccc(O[C@@H](C)C(N)=O)cc1OCC2 |
| InChI | InChI=1S/C19H22N6O3/c1-11(2)25-19(21-10-22-25)15-9-24-6-7-27-16-8-13(28-12(3)17(20)26)4-5-14(16)18(24)23-15/h4-5,8-12H,6-7H2,1-3H3,(H2,20,26)/t12-/m0/s1 |
| InChIKey | SIKYDKLGPWRPMZ-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDC-0326 (CHEBI:229938) has role antineoplastic agent (CHEBI:35610) |
| GDC-0326 (CHEBI:229938) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| GDC-0326 (CHEBI:229938) is a ether (CHEBI:25698) |
| GDC-0326 (CHEBI:229938) is a organic heterotricyclic compound (CHEBI:26979) |
| GDC-0326 (CHEBI:229938) is a primary carboxamide (CHEBI:140324) |
| GDC-0326 (CHEBI:229938) is a tertiary amino compound (CHEBI:50996) |
| GDC-0326 (CHEBI:229938) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (2S)-2-({2-[1-(propan-2-yl)-1H-1,2,4-triazol-5-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl}oxy)propanamide |
| Synonyms | Source |
|---|---|
| GDC0326 | SUBMITTER |
| GDC 0326 | ChEBI |
| (S)-2-((2-(1-Isopropyl-1H-1,2,4-triazol-5-yl)-5,6-dihydrobenzo[f]imidazo[1,2-d][1,4]oxazepin-9-yl)oxy)propanamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5H5 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1282514-88-8 | ChEBI |
| Citations |
|---|