EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2OS.HBr |
| Net Charge | 0 |
| Average Mass | 367.312 |
| Monoisotopic Mass | 366.04015 |
| SMILES | Br.Cc1ccc(C(=O)Cn2c3c(sc2=N)CCCC3)cc1 |
| InChI | InChI=1S/C16H18N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9,17H,2-5,10H2,1H3;1H |
| InChIKey | HAGVCKULCLQGRF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). p53 inhibitor Any inhibitor of tumour protein p53. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pifithrin-α hydrobromide (CHEBI:229924) has part 3-[2-(4-methylphenyl)-2-oxoethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2(3H)-iminium (CHEBI:233675) |
| pifithrin-α hydrobromide (CHEBI:229924) has role apoptosis inhibitor (CHEBI:68494) |
| pifithrin-α hydrobromide (CHEBI:229924) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| pifithrin-α hydrobromide (CHEBI:229924) has role hepatoprotective agent (CHEBI:62868) |
| pifithrin-α hydrobromide (CHEBI:229924) has role p53 inhibitor (CHEBI:232442) |
| pifithrin-α hydrobromide (CHEBI:229924) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| 2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3(2H)-yl)-1-(4-methylphenyl)ethanone hydrobromide |
| Synonyms | Source |
|---|---|
| 2-(2-imino-4,5,6,7-tetrahydrobenzothiazol-3-yl)-1-p-tolylethanone hydrobromide | ChEBI |
| PFT-α | ChEBI |
| PFTα | ChEBI |
| pifithrin-α | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 19952120 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:63208-82-2 | ChEBI |
| Citations |
|---|