EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2OS.HBr |
| Net Charge | 0 |
| Average Mass | 367.312 |
| Monoisotopic Mass | 366.04015 |
| SMILES | Br.Cc1ccc(C(=O)Cn2c3c(sc2=N)CCCC3)cc1 |
| InChI | InChI=1S/C16H18N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9,17H,2-5,10H2,1H3;1H |
| InChIKey | HAGVCKULCLQGRF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Biological Roles: | p53 inhibitor Any inhibitor of tumour protein p53. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pifithrin-α hydrobromide (CHEBI:229924) has part 3-[2-(4-methylphenyl)-2-oxoethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2(3H)-iminium (CHEBI:233675) |
| pifithrin-α hydrobromide (CHEBI:229924) has role apoptosis inhibitor (CHEBI:68494) |
| pifithrin-α hydrobromide (CHEBI:229924) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| pifithrin-α hydrobromide (CHEBI:229924) has role hepatoprotective agent (CHEBI:62868) |
| pifithrin-α hydrobromide (CHEBI:229924) has role p53 inhibitor (CHEBI:232442) |
| pifithrin-α hydrobromide (CHEBI:229924) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| 2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3(2H)-yl)-1-(4-methylphenyl)ethanone hydrobromide |
| Synonyms | Source |
|---|---|
| pifithrin-α | ChEBI |
| PFT-α | ChEBI |
| 2-(2-imino-4,5,6,7-tetrahydrobenzothiazol-3-yl)-1-p-tolylethanone hydrobromide | ChEBI |
| PFTα | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 19952120 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:63208-82-2 | ChEBI |
| Citations |
|---|