EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30N2O5 |
| Net Charge | 0 |
| Average Mass | 546.623 |
| Monoisotopic Mass | 546.21547 |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C34H30N2O5/c1-23-29(36-33(41-23)26-12-6-3-7-13-26)20-21-40-27-18-16-24(17-19-27)22-31(34(38)39)35-30-15-9-8-14-28(30)32(37)25-10-4-2-5-11-25/h2-19,31,35H,20-22H2,1H3,(H,38,39)/t31-/m0/s1 |
| InChIKey | ZZCHHVUQYRMYLW-HKBQPEDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farglitazar (CHEBI:229920) has role hepatoprotective agent (CHEBI:62868) |
| farglitazar (CHEBI:229920) is a phenylalanine derivative (CHEBI:25985) |
| IUPAC Name |
|---|
| (2S)-2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid |
| INN | Source |
|---|---|
| farglitazar | WHO MedNet |
| Synonyms | Source |
|---|---|
| G1-262570 | ChEMBL |
| Gi262570 | ChEMBL |
| GI-262570 | ChEMBL |
| GI-262570X | ChEMBL |
| GI262570X | ChEMBL |
| Citations |
|---|