EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18D6O7 |
| Net Charge | 0 |
| Average Mass | 334.398 |
| Monoisotopic Mass | 334.18986 |
| SMILES | [2H]C([2H])(CC(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCC(=O)O)C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C16H24O7/c17-10(3-1-2-4-15(20)21)5-6-11-12(7-8-16(22)23)14(19)9-13(11)18/h11-13,18H,1-9H2,(H,20,21)(H,22,23)/t11-,12-,13-/m1/s1/i1D2,2D2,4D2 |
| InChIKey | ZJAZCYLYLVCSNH-VFBFAAMGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetranor-pgem-d6 (CHEBI:229917) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 8-[(1R,2R,5R)-2-(2-carboxyethyl)-5-hydroxy-3-oxocyclopentyl]-2,2,3,3,4,4-hexadeuterio-6-oxooctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29341953 | ChemSpider |
| LMFA03010175 | LIPID MAPS |