EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H41ClN2O9 |
| Net Charge | 0 |
| Average Mass | 645.149 |
| Monoisotopic Mass | 644.25006 |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)N3CCC(CC(=O)O)CC3)C(=O)N(CC(C)(C)COC(C)=O)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C33H41ClN2O9/c1-20(37)44-19-33(2,3)18-36-25-10-9-22(34)16-24(25)30(23-7-6-8-26(42-4)31(23)43-5)45-27(32(36)41)17-28(38)35-13-11-21(12-14-35)15-29(39)40/h6-10,16,21,27,30H,11-15,17-19H2,1-5H3,(H,39,40)/t27-,30-/m1/s1 |
| InChIKey | CMLUGNQVANVZHY-POURPWNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tak-475 (CHEBI:229906) has role anticholesteremic drug (CHEBI:35821) |
| tak-475 (CHEBI:229906) has role hypoglycemic agent (CHEBI:35526) |
| tak-475 (CHEBI:229906) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| tak-475 (CHEBI:229906) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| 2-[1-[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]piperidin-4-yl]acetic acid |
| Synonyms | Source |
|---|---|
| lapaquistat acetate | ChEMBL |
| Lapaquistat acetate | ChEMBL |
| TAK 475 | ChEMBL |
| TAK-475 | ChEMBL |
| TAK475 | ChEMBL |
| Citations |
|---|