EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33N7O5S |
| Net Charge | 0 |
| Average Mass | 519.628 |
| Monoisotopic Mass | 519.22639 |
| SMILES | CCOc1ncc(S(=O)(=O)N2CCN(CC)CC2)cc1-c1nc(=O)c2nn(CCOC)c(CC)c2n1 |
| InChI | InChI=1S/C23H33N7O5S/c1-5-18-19-20(27-30(18)12-13-34-4)22(31)26-21(25-19)17-14-16(15-24-23(17)35-7-3)36(32,33)29-10-8-28(6-2)9-11-29/h14-15H,5-13H2,1-4H3,(H,25,26,31) |
| InChIKey | YPFZMBHKIVDSNR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gisadenafil (CHEBI:229886) has role vasodilator agent (CHEBI:35620) |
| gisadenafil (CHEBI:229886) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 5-[2-ethoxy-5-(4-ethylpiperazin-1-yl)sulonylpyridin-3-yl]-3-ethyl-2-(2-methoxyethyl)-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| INNs | Source |
|---|---|
| gisadenafil | WHO MedNet |
| gisadenafilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| UK-369,003 | ChEMBL |
| UK-369003 | ChEMBL |
| Citations |
|---|