EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32F6O3 |
| Net Charge | 0 |
| Average Mass | 506.527 |
| Monoisotopic Mass | 506.22556 |
| SMILES | C[C@H](CC#CC(O)(C(F)(F)F)C(F)(F)F)C1=CC[C@H]2/C(=C/C=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C26H32F6O3/c1-16(5-3-12-24(35,25(27,28)29)26(30,31)32)21-9-10-22-18(6-4-11-23(21,22)2)8-7-17-13-19(33)15-20(34)14-17/h7-9,16,19-20,22,33-35H,4-6,10-11,13-15H2,1-2H3/b18-8+/t16-,19-,20-,22+,23-/m1/s1 |
| InChIKey | NMTKDFODVOFVPG-WGNVYDHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,25-dihydroxy-26,26,26,27,27,27-hexafluoro-16,17,23,23,24,24-hexadehydro-19-norvitamin d3 / 1alpha,25-dihydroxy-26,26,26,27,27,27-hexafluoro-16,17,23,23,24,24-hexadehydro-19-norcholecalciferol (CHEBI:229878) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3R)-5-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R)-7,7,7-triluoro-6-hydroxy-6-(triluoromethyl)hept-4-yn-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826587 | ChemSpider |
| LMST03020545 | LIPID MAPS |